C23H27N5O4S — CID 89437726
[methyl-[[4-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]cyclohexyl]carbamoyl]amino] acetate (PubChem CID 89437726) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is [methyl-[[4-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]cyclohexyl]carbamoyl]amino] acetate.
| Compound Name | [methyl-[[4-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]cyclohexyl]carbamoyl]amino] acetate |
|---|---|
| PubChem CID | 89437726 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | [methyl-[[4-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]cyclohexyl]carbamoyl]amino] acetate |
| SMILES | CC(=O)ON(C)C(=O)NC1CCC(NC(=O)c2cc3c(C)nn(-c4ccccc4)c3s2)CC1 |
| InChI | InChI=1S/C23H27N5O4S/c1-14-19-13-20(33-22(19)28(26-14)18-7-5-4-6-8-18)21(30)24-16-9-11-17(12-10-16)25-23(31)27(3)32-15(2)29/h4-8,13,16-17H,9-12H2,1-3H3,(H,24,30)(H,25,31) |
| InChIKey | GIIHVPOHVFHYRZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|