C18H19N5O4S — CID 89437742
[carbamoyl-[2-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]ethyl]amino] acetate (PubChem CID 89437742) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is [carbamoyl-[2-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]ethyl]amino] acetate.
| Compound Name | [carbamoyl-[2-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]ethyl]amino] acetate |
|---|---|
| PubChem CID | 89437742 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | [carbamoyl-[2-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]ethyl]amino] acetate |
| SMILES | CC(=O)ON(CCNC(=O)c1cc2c(C)nn(-c3ccccc3)c2s1)C(N)=O |
| InChI | InChI=1S/C18H19N5O4S/c1-11-14-10-15(16(25)20-8-9-22(18(19)26)27-12(2)24)28-17(14)23(21-11)13-6-4-3-5-7-13/h3-7,10H,8-9H2,1-2H3,(H2,19,26)(H,20,25) |
| InChIKey | CRRWUQDNJFDDDC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|