C15H32O2 — CID 89439666
4,4-bis(2-methylpropoxy)heptane (PubChem CID 89439666) has the molecular formula C15H32O2 and a molecular weight of 244.42 g/mol. Its IUPAC name is 4,4-bis(2-methylpropoxy)heptane.
| Compound Name | 4,4-bis(2-methylpropoxy)heptane |
|---|---|
| PubChem CID | 89439666 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | 4,4-bis(2-methylpropoxy)heptane |
| SMILES | CCCC(CCC)(OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C15H32O2/c1-7-9-15(10-8-2,16-11-13(3)4)17-12-14(5)6/h13-14H,7-12H2,1-6H3 |
| InChIKey | YGVYLPPCALMZEQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|