C29H34O — CID 89442381
2-(3-tert-butyl-2-methoxy-5-methylphenyl)-9,9-diethylfluorene (PubChem CID 89442381) has the molecular formula C29H34O and a molecular weight of 398.59 g/mol. Its IUPAC name is 2-(3-tert-butyl-2-methoxy-5-methylphenyl)-9,9-diethylfluorene.
| Compound Name | 2-(3-tert-butyl-2-methoxy-5-methylphenyl)-9,9-diethylfluorene |
|---|---|
| PubChem CID | 89442381 |
| Molecular Formula | C29H34O |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 2-(3-tert-butyl-2-methoxy-5-methylphenyl)-9,9-diethylfluorene |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(-c3cc(C)cc(C(C)(C)C)c3OC)cc21 |
| InChI | InChI=1S/C29H34O/c1-8-29(9-2)24-13-11-10-12-21(24)22-15-14-20(18-25(22)29)23-16-19(3)17-26(27(23)30-7)28(4,5)6/h10-18H,8-9H2,1-7H3 |
| InChIKey | SFMVXSVPYCWAON-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |