C12H23NO4 — CID 89442559
2,2,3-trideuterio-3-(2-methylbutanoyloxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 89442559) has the molecular formula C12H23NO4 and a molecular weight of 248.34 g/mol. Its IUPAC name is 2,2,3-trideuterio-3-(2-methylbutanoyloxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | 2,2,3-trideuterio-3-(2-methylbutanoyloxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 89442559 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 2,2,3-trideuterio-3-(2-methylbutanoyloxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | [2H]C(C[N+](C)(C)C)(OC(=O)C(C)CC)C([2H])([2H])C(=O)[O-] |
| InChI | InChI=1S/C12H23NO4/c1-6-9(2)12(16)17-10(7-11(14)15)8-13(3,4)5/h9-10H,6-8H2,1-5H3/i7D2,10D |
| InChIKey | IHCPDBBYTYJYIL-QBYKPWDVSA-N |
| XLogP | -0.21 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|