C9H18NO4+ — CID 126519204
(2-acetyloxy-3-carboxy-2,3,3-trideuteriopropyl)-trimethylazanium (PubChem CID 126519204) has the molecular formula C9H18NO4+ and a molecular weight of 207.26 g/mol. Its IUPAC name is (2-acetyloxy-3-carboxy-2,3,3-trideuteriopropyl)-trimethylazanium.
| Compound Name | (2-acetyloxy-3-carboxy-2,3,3-trideuteriopropyl)-trimethylazanium |
|---|---|
| PubChem CID | 126519204 |
| Molecular Formula | C9H18NO4+ |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (2-acetyloxy-3-carboxy-2,3,3-trideuteriopropyl)-trimethylazanium |
| SMILES | [2H]C(C[N+](C)(C)C)(OC(C)=O)C([2H])([2H])C(=O)O |
| InChI | InChI=1S/C9H17NO4/c1-7(11)14-8(5-9(12)13)6-10(2,3)4/h8H,5-6H2,1-4H3/p+1/i5D2,8D |
| InChIKey | RDHQFKQIGNGIED-VWTWQGAWSA-O |
| XLogP | 0.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|