C9H17NO4 — CID 46213990
(3R)-3-acetyloxy-3,4,4-trideuterio-4-[tris(trideuteriomethyl)azaniumyl]butanoate (PubChem CID 46213990) has the molecular formula C9H17NO4 and a molecular weight of 215.31 g/mol. Its IUPAC name is (3R)-3-acetyloxy-3,4,4-trideuterio-4-[tris(trideuteriomethyl)azaniumyl]butanoate.
| Compound Name | (3R)-3-acetyloxy-3,4,4-trideuterio-4-[tris(trideuteriomethyl)azaniumyl]butanoate |
|---|---|
| PubChem CID | 46213990 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 215.31 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | (3R)-3-acetyloxy-3,4,4-trideuterio-4-[tris(trideuteriomethyl)azaniumyl]butanoate |
| SMILES | [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[C@@]([2H])(CC(=O)[O-])OC(C)=O |
| InChI | InChI=1S/C9H17NO4/c1-7(11)14-8(5-9(12)13)6-10(2,3)4/h8H,5-6H2,1-4H3/t8-/m1/s1/i2D3,3D3,4D3,6D2,8D |
| InChIKey | RDHQFKQIGNGIED-ADFRICLDSA-N |
| XLogP | -1.24 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.31 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|