C7H15NO3 — CID 59324226
(3R)-3,4,4-trideuterio-3-hydroxy-4-(trimethylazaniumyl)butanoate (PubChem CID 59324226) has the molecular formula C7H15NO3 and a molecular weight of 164.22 g/mol. Its IUPAC name is (3R)-3,4,4-trideuterio-3-hydroxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | (3R)-3,4,4-trideuterio-3-hydroxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 59324226 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 164.22 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (3R)-3,4,4-trideuterio-3-hydroxy-4-(trimethylazaniumyl)butanoate |
| SMILES | [2H]C([2H])([C@]([2H])(O)CC(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/t6-/m1/s1/i5D2,6D |
| InChIKey | PHIQHXFUZVPYII-FHPMZSISSA-N |
| XLogP | -1.81 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.22 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|