C7H15NO3 — CID 46215505
(3R)-2,2,4,4-tetradeuterio-4-[dimethyl(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate (PubChem CID 46215505) has the molecular formula C7H15NO3 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3R)-2,2,4,4-tetradeuterio-4-[dimethyl(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate.
| Compound Name | (3R)-2,2,4,4-tetradeuterio-4-[dimethyl(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 46215505 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3R)-2,2,4,4-tetradeuterio-4-[dimethyl(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate |
| SMILES | [2H]C([2H])(C(=O)[O-])[C@@H](O)C([2H])([2H])[N+](C)(C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/t6-/m1/s1/i1D3,4D2,5D2 |
| InChIKey | PHIQHXFUZVPYII-SOXICGIVSA-N |
| XLogP | -1.81 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|