C8H17NO3 — CID 59324222
(3R)-3,4,4-trideuterio-4-[1,1-dideuterioethyl-bis(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate (PubChem CID 59324222) has the molecular formula C8H17NO3 and a molecular weight of 186.30 g/mol. Its IUPAC name is (3R)-3,4,4-trideuterio-4-[1,1-dideuterioethyl-bis(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate.
| Compound Name | (3R)-3,4,4-trideuterio-4-[1,1-dideuterioethyl-bis(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 59324222 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.19 |
| IUPAC Name | (3R)-3,4,4-trideuterio-4-[1,1-dideuterioethyl-bis(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate |
| SMILES | [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])C)C([2H])([2H])[C@]([2H])(O)CC(=O)[O-] |
| InChI | InChI=1S/C8H17NO3/c1-4-9(2,3)6-7(10)5-8(11)12/h7,10H,4-6H2,1-3H3/t7-/m1/s1/i2D3,3D3,4D2,6D2,7D |
| InChIKey | WQBGFJZQZGKHTE-LPQCRYJCSA-N |
| XLogP | -1.42 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|