C7H16NO3+ — CID 59324227
[(2R)-3-carboxy-1,1,2-trideuterio-2-hydroxypropyl]-trimethylazanium (PubChem CID 59324227) has the molecular formula C7H16NO3+ and a molecular weight of 165.23 g/mol. Its IUPAC name is [(2R)-3-carboxy-1,1,2-trideuterio-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-1,1,2-trideuterio-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 59324227 |
| Molecular Formula | C7H16NO3+ |
| Molecular Weight | 165.23 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | [(2R)-3-carboxy-1,1,2-trideuterio-2-hydroxypropyl]-trimethylazanium |
| SMILES | [2H]C([2H])([C@]([2H])(O)CC(=O)O)[N+](C)(C)C |
| InChI | InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/p+1/t6-/m1/s1/i5D2,6D |
| InChIKey | PHIQHXFUZVPYII-FHPMZSISSA-O |
| XLogP | -0.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|