C20H26F4N2O4 — CID 89442664
N-ethyl-4-fluoro-N-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]-3-(trifluoromethyl)benzeneamine oxide (PubChem CID 89442664) has the molecular formula C20H26F4N2O4 and a molecular weight of 434.43 g/mol. Its IUPAC name is N-ethyl-4-fluoro-N-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]-3-(trifluoromethyl)benzeneamine oxide.
| Compound Name | N-ethyl-4-fluoro-N-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]-3-(trifluoromethyl)benzeneamine oxide |
|---|---|
| PubChem CID | 89442664 |
| Molecular Formula | C20H26F4N2O4 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-ethyl-4-fluoro-N-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]-3-(trifluoromethyl)benzeneamine oxide |
| SMILES | CC[N+]([O-])(C(=O)C1CCN(C(=O)OC(C)(C)C)CC1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H26F4N2O4/c1-5-26(29,14-6-7-16(21)15(12-14)20(22,23)24)17(27)13-8-10-25(11-9-13)18(28)30-19(2,3)4/h6-7,12-13H,5,8-11H2,1-4H3 |
| InChIKey | GBSZJRXEJVKAOW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|