C25H34ClN3O3Si — CID 89446985
N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-chloro-N-(3,5-dimethoxyphenyl)quinoxalin-6-amine (PubChem CID 89446985) has the molecular formula C25H34ClN3O3Si and a molecular weight of 488.10 g/mol. Its IUPAC name is N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-chloro-N-(3,5-dimethoxyphenyl)quinoxalin-6-amine.
| Compound Name | N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-chloro-N-(3,5-dimethoxyphenyl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 89446985 |
| Molecular Formula | C25H34ClN3O3Si |
| Molecular Weight | 488.10 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-chloro-N-(3,5-dimethoxyphenyl)quinoxalin-6-amine |
| SMILES | COc1cc(OC)cc(N(CCCO[Si](C)(C)C(C)(C)C)c2ccc3ncc(Cl)nc3c2)c1 |
| InChI | InChI=1S/C25H34ClN3O3Si/c1-25(2,3)33(6,7)32-12-8-11-29(19-13-20(30-4)16-21(14-19)31-5)18-9-10-22-23(15-18)28-24(26)17-27-22/h9-10,13-17H,8,11-12H2,1-7H3 |
| InChIKey | YGGKNBQPKTVJEK-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.10 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|