C27H22N2O3S — CID 89448907
[(1R)-1-phenylethyl] N-[3-methyl-5-[2-[6-(2-oxoethyl)naphthalen-2-yl]ethynyl]-1,2-thiazol-4-yl]carbamate (PubChem CID 89448907) has the molecular formula C27H22N2O3S and a molecular weight of 454.55 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] N-[3-methyl-5-[2-[6-(2-oxoethyl)naphthalen-2-yl]ethynyl]-1,2-thiazol-4-yl]carbamate.
| Compound Name | [(1R)-1-phenylethyl] N-[3-methyl-5-[2-[6-(2-oxoethyl)naphthalen-2-yl]ethynyl]-1,2-thiazol-4-yl]carbamate |
|---|---|
| PubChem CID | 89448907 |
| Molecular Formula | C27H22N2O3S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [(1R)-1-phenylethyl] N-[3-methyl-5-[2-[6-(2-oxoethyl)naphthalen-2-yl]ethynyl]-1,2-thiazol-4-yl]carbamate |
| SMILES | Cc1nsc(C#Cc2ccc3cc(CC=O)ccc3c2)c1NC(=O)O[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H22N2O3S/c1-18-26(28-27(31)32-19(2)22-6-4-3-5-7-22)25(33-29-18)13-10-20-8-11-24-17-21(14-15-30)9-12-23(24)16-20/h3-9,11-12,15-17,19H,14H2,1-2H3,(H,28,31)/t19-/m1/s1 |
| InChIKey | BGPRGVNCDRONEC-LJQANCHMSA-N |
| XLogP | 6.06 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|