C7H8F3O3P — CID 89449796
5-ethynyl-2-methoxy-4-(trifluoromethyl)-1,2λ5-oxaphospholane 2-oxide (PubChem CID 89449796) has the molecular formula C7H8F3O3P and a molecular weight of 228.11 g/mol. Its IUPAC name is 5-ethynyl-2-methoxy-4-(trifluoromethyl)-1,2λ5-oxaphospholane 2-oxide.
| Compound Name | 5-ethynyl-2-methoxy-4-(trifluoromethyl)-1,2λ5-oxaphospholane 2-oxide |
|---|---|
| PubChem CID | 89449796 |
| Molecular Formula | C7H8F3O3P |
| Molecular Weight | 228.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 5-ethynyl-2-methoxy-4-(trifluoromethyl)-1,2λ5-oxaphospholane 2-oxide |
| SMILES | C#CC1OP(=O)(OC)CC1C(F)(F)F |
| InChI | InChI=1S/C7H8F3O3P/c1-3-6-5(7(8,9)10)4-14(11,12-2)13-6/h1,5-6H,4H2,2H3 |
| InChIKey | BBVUZAHKLRVVSB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.11 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|