About [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol
[(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol (PubChem CID 138632639) has the molecular formula C5H11O4P
and a molecular weight of 166.11 g/mol. Its IUPAC name is [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol |
| PubChem CID | 138632639 |
| Molecular Formula | C5H11O4P |
| Molecular Weight | 166.11 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol |
| SMILES | CO[P@@]1(=O)CC(CO)CO1 |
| InChI | InChI=1S/C5H11O4P/c1-8-10(7)4-5(2-6)3-9-10/h5-6H,2-4H2,1H3/t5?,10-/m0/s1 |
| InChIKey | FJVYUBMJBLHJEG-MDNDIQLQSA-N |
| XLogP | 0.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.11 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol?
The IUPAC name of [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol (CID 138632639) is [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol.
What is the SMILES notation for [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol?
The canonical SMILES for [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol is CO[P@@]1(=O)CC(CO)CO1.
What is the InChIKey of [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol?
The InChIKey is FJVYUBMJBLHJEG-MDNDIQLQSA-N. The full InChI is InChI=1S/C5H11O4P/c1-8-10(7)4-5(2-6)3-9-10/h5-6H,2-4H2,1H3/t5?,10-/m0/s1.
What are the key properties of [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol?
[(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol has a molecular weight of 166.11 g/mol, XLogP of 0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-methoxy-2-oxo-1,2λ5-oxaphospholan-4-yl]methanol is sourced from PubChem (CID 138632639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).