C6H13O4P — CID 13309995
(2R,3S,4R)-2-methoxy-3,4-dimethyl-2-oxo-1,2lambda5-oxaphospholan-3-ol (PubChem CID 13309995) has the molecular formula C6H13O4P and a molecular weight of 180.14 g/mol. Its IUPAC name is (2R,3S,4R)-2-methoxy-3,4-dimethyl-2-oxo-1,2lambda5-oxaphospholan-3-ol.
| Compound Name | (2R,3S,4R)-2-methoxy-3,4-dimethyl-2-oxo-1,2lambda5-oxaphospholan-3-ol |
|---|---|
| PubChem CID | 13309995 |
| Molecular Formula | C6H13O4P |
| Molecular Weight | 180.14 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (2R,3S,4R)-2-methoxy-3,4-dimethyl-2-oxo-1,2lambda5-oxaphospholan-3-ol |
| SMILES | CO[P@@]1(=O)OC[C@@H](C)[C@@]1(C)O |
| InChI | InChI=1S/C6H13O4P/c1-5-4-10-11(8,9-3)6(5,2)7/h5,7H,4H2,1-3H3/t5-,6+,11-/m1/s1 |
| InChIKey | JSEUGISGCSTXLN-LJNABYEQSA-N |
| XLogP | 1.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|