C5H11O4P — CID 23420977
(2S,3R,5S)-2-methoxy-5-methyl-2-oxo-1,2λ5-oxaphospholan-3-ol (PubChem CID 23420977) has the molecular formula C5H11O4P and a molecular weight of 166.11 g/mol. Its IUPAC name is (2S,3R,5S)-2-methoxy-5-methyl-2-oxo-1,2λ5-oxaphospholan-3-ol.
| Compound Name | (2S,3R,5S)-2-methoxy-5-methyl-2-oxo-1,2λ5-oxaphospholan-3-ol |
|---|---|
| PubChem CID | 23420977 |
| Molecular Formula | C5H11O4P |
| Molecular Weight | 166.11 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | (2S,3R,5S)-2-methoxy-5-methyl-2-oxo-1,2λ5-oxaphospholan-3-ol |
| SMILES | CO[P@]1(=O)O[C@@H](C)C[C@@H]1O |
| InChI | InChI=1S/C5H11O4P/c1-4-3-5(6)10(7,8-2)9-4/h4-6H,3H2,1-2H3/t4-,5+,10-/m0/s1 |
| InChIKey | DAFIDEDRUUHSFZ-LYAQYDMKSA-N |
| XLogP | 0.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.11 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|