C6H13O3P — CID 58422993
2-ethyl-4-methyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 58422993) has the molecular formula C6H13O3P and a molecular weight of 164.14 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-ethyl-4-methyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 58422993 |
| Molecular Formula | C6H13O3P |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 2-ethyl-4-methyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CCP1(=O)OCCC(C)O1 |
| InChI | InChI=1S/C6H13O3P/c1-3-10(7)8-5-4-6(2)9-10/h6H,3-5H2,1-2H3 |
| InChIKey | CLKANCXTGZEZJL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|