C5H8F3O3PS — CID 23416371
(2S,4S)-4-methyl-2-(trifluoromethylsulfanyl)-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 23416371) has the molecular formula C5H8F3O3PS and a molecular weight of 236.15 g/mol. Its IUPAC name is (2S,4S)-4-methyl-2-(trifluoromethylsulfanyl)-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | (2S,4S)-4-methyl-2-(trifluoromethylsulfanyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 23416371 |
| Molecular Formula | C5H8F3O3PS |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | (2S,4S)-4-methyl-2-(trifluoromethylsulfanyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | C[C@H]1CCO[P@](=O)(SC(F)(F)F)O1 |
| InChI | InChI=1S/C5H8F3O3PS/c1-4-2-3-10-12(9,11-4)13-5(6,7)8/h4H,2-3H2,1H3/t4-,12-/m0/s1 |
| InChIKey | GNFFAIXXFZFZKB-GPWCVORUSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|