C4H8ClO3PS — CID 12654512
[(2R,4S)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl] thiohypochlorite (PubChem CID 12654512) has the molecular formula C4H8ClO3PS and a molecular weight of 202.60 g/mol. Its IUPAC name is [(2R,4S)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl] thiohypochlorite.
| Compound Name | [(2R,4S)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl] thiohypochlorite |
|---|---|
| PubChem CID | 12654512 |
| Molecular Formula | C4H8ClO3PS |
| Molecular Weight | 202.60 g/mol |
| Exact Mass | 201.96 |
| IUPAC Name | [(2R,4S)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl] thiohypochlorite |
| SMILES | C[C@H]1CCO[P@@](=O)(SCl)O1 |
| InChI | InChI=1S/C4H8ClO3PS/c1-4-2-3-7-9(6,8-4)10-5/h4H,2-3H2,1H3/t4-,9+/m0/s1 |
| InChIKey | AUFOFOJZJGEHMW-AJAUBTJJSA-N |
| XLogP | 2.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|