C4H8BrO3P — CID 23419061
(2R,4R)-2-bromo-4-methyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 23419061) has the molecular formula C4H8BrO3P and a molecular weight of 214.98 g/mol. Its IUPAC name is (2R,4R)-2-bromo-4-methyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | (2R,4R)-2-bromo-4-methyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 23419061 |
| Molecular Formula | C4H8BrO3P |
| Molecular Weight | 214.98 g/mol |
| Exact Mass | 213.94 |
| IUPAC Name | (2R,4R)-2-bromo-4-methyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | C[C@@H]1CCO[P@@](=O)(Br)O1 |
| InChI | InChI=1S/C4H8BrO3P/c1-4-2-3-7-9(5,6)8-4/h4H,2-3H2,1H3/t4-,9+/m1/s1 |
| InChIKey | QHUHXFJTJZVXTG-MOFOKWOHSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.98 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|