C12H24NO3P — CID 23263743
4-[2-(diethylamino)-4-methyl-1,3,2λ5-dioxaphosphinan-2-ylidene]butan-2-one (PubChem CID 23263743) has the molecular formula C12H24NO3P and a molecular weight of 261.30 g/mol. Its IUPAC name is 4-[2-(diethylamino)-4-methyl-1,3,2λ5-dioxaphosphinan-2-ylidene]butan-2-one.
| Compound Name | 4-[2-(diethylamino)-4-methyl-1,3,2λ5-dioxaphosphinan-2-ylidene]butan-2-one |
|---|---|
| PubChem CID | 23263743 |
| Molecular Formula | C12H24NO3P |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-[2-(diethylamino)-4-methyl-1,3,2λ5-dioxaphosphinan-2-ylidene]butan-2-one |
| SMILES | CCN(CC)P1(=CCC(C)=O)OCCC(C)O1 |
| InChI | InChI=1S/C12H24NO3P/c1-5-13(6-2)17(10-8-11(3)14)15-9-7-12(4)16-17/h10,12H,5-9H2,1-4H3 |
| InChIKey | FQBNUJSZBYKYOF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|