C8H18NO3P — CID 23416093
(4R,5S)-N,N-diethyl-4,5-dimethyl-2-oxo-1,3,2λ5-dioxaphospholan-2-amine (PubChem CID 23416093) has the molecular formula C8H18NO3P and a molecular weight of 207.21 g/mol. Its IUPAC name is (4R,5S)-N,N-diethyl-4,5-dimethyl-2-oxo-1,3,2λ5-dioxaphospholan-2-amine.
| Compound Name | (4R,5S)-N,N-diethyl-4,5-dimethyl-2-oxo-1,3,2λ5-dioxaphospholan-2-amine |
|---|---|
| PubChem CID | 23416093 |
| Molecular Formula | C8H18NO3P |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (4R,5S)-N,N-diethyl-4,5-dimethyl-2-oxo-1,3,2λ5-dioxaphospholan-2-amine |
| SMILES | CCN(CC)P1(=O)O[C@@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/C8H18NO3P/c1-5-9(6-2)13(10)11-7(3)8(4)12-13/h7-8H,5-6H2,1-4H3/t7-,8+,13? |
| InChIKey | QGZMHJYPGLZOEX-RKSAZJRESA-N |
| XLogP | 2.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|