C8H13O5P — CID 20501260
4-[(4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]oxetan-2-one (PubChem CID 20501260) has the molecular formula C8H13O5P and a molecular weight of 220.16 g/mol. Its IUPAC name is 4-[(4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]oxetan-2-one.
| Compound Name | 4-[(4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]oxetan-2-one |
|---|---|
| PubChem CID | 20501260 |
| Molecular Formula | C8H13O5P |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 4-[(4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]oxetan-2-one |
| SMILES | CC1CCOP(=O)(CC2CC(=O)O2)O1 |
| InChI | InChI=1S/C8H13O5P/c1-6-2-3-11-14(10,13-6)5-7-4-8(9)12-7/h6-7H,2-5H2,1H3 |
| InChIKey | OIBOMQHEGMSQKQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|