C6H13OPS — CID 11899665
(2R,5R)-2-ethyl-5-methyl-2-sulfanylidene-1,2λ5-oxaphospholane (PubChem CID 11899665) has the molecular formula C6H13OPS and a molecular weight of 164.21 g/mol. Its IUPAC name is (2R,5R)-2-ethyl-5-methyl-2-sulfanylidene-1,2λ5-oxaphospholane.
| Compound Name | (2R,5R)-2-ethyl-5-methyl-2-sulfanylidene-1,2λ5-oxaphospholane |
|---|---|
| PubChem CID | 11899665 |
| Molecular Formula | C6H13OPS |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | (2R,5R)-2-ethyl-5-methyl-2-sulfanylidene-1,2λ5-oxaphospholane |
| SMILES | CC[P@@]1(=S)CC[C@@H](C)O1 |
| InChI | InChI=1S/C6H13OPS/c1-3-8(9)5-4-6(2)7-8/h6H,3-5H2,1-2H3/t6-,8-/m1/s1 |
| InChIKey | IZZALKQMXQUZJF-HTRCEHHLSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|