C5H11O3PS — CID 11849492
(2-methoxy-2-sulfanylidene-1,2lambda5-oxaphospholan-5-yl)methanol (PubChem CID 11849492) has the molecular formula C5H11O3PS and a molecular weight of 182.18 g/mol. Its IUPAC name is (2-methoxy-2-sulfanylidene-1,2lambda5-oxaphospholan-5-yl)methanol.
| Compound Name | (2-methoxy-2-sulfanylidene-1,2lambda5-oxaphospholan-5-yl)methanol |
|---|---|
| PubChem CID | 11849492 |
| Molecular Formula | C5H11O3PS |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | (2-methoxy-2-sulfanylidene-1,2lambda5-oxaphospholan-5-yl)methanol |
| SMILES | COP1(=S)CCC(CO)O1 |
| InChI | InChI=1S/C5H11O3PS/c1-7-9(10)3-2-5(4-6)8-9/h5-6H,2-4H2,1H3 |
| InChIKey | OSZVTQBPNSMXIE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|