C6H13O5P — CID 23420980
(2R,3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-4-methyl-2-oxo-1,2λ5-oxaphospholan-3-ol (PubChem CID 23420980) has the molecular formula C6H13O5P and a molecular weight of 196.14 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-4-methyl-2-oxo-1,2λ5-oxaphospholan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-4-methyl-2-oxo-1,2λ5-oxaphospholan-3-ol |
|---|---|
| PubChem CID | 23420980 |
| Molecular Formula | C6H13O5P |
| Molecular Weight | 196.14 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (2R,3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-4-methyl-2-oxo-1,2λ5-oxaphospholan-3-ol |
| SMILES | CO[P@@]1(=O)O[C@@H](CO)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C6H13O5P/c1-4-5(3-7)11-12(9,10-2)6(4)8/h4-8H,3H2,1-2H3/t4-,5+,6-,12-/m1/s1 |
| InChIKey | TXEUFQALBCSLND-DHYPPZMMSA-N |
| XLogP | 0.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.14 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|