C12H17O7P — CID 11403936
(2S,3S,4R,5S,6R)-6-(hydroxymethyl)-2-oxo-2-phenylmethoxy-1,2λ5-oxaphosphinane-3,4,5-triol (PubChem CID 11403936) has the molecular formula C12H17O7P and a molecular weight of 304.24 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-6-(hydroxymethyl)-2-oxo-2-phenylmethoxy-1,2λ5-oxaphosphinane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6R)-6-(hydroxymethyl)-2-oxo-2-phenylmethoxy-1,2λ5-oxaphosphinane-3,4,5-triol |
|---|---|
| PubChem CID | 11403936 |
| Molecular Formula | C12H17O7P |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2S,3S,4R,5S,6R)-6-(hydroxymethyl)-2-oxo-2-phenylmethoxy-1,2λ5-oxaphosphinane-3,4,5-triol |
| SMILES | O=[P@@]1(OCc2ccccc2)O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H17O7P/c13-6-9-10(14)11(15)12(16)20(17,19-9)18-7-8-4-2-1-3-5-8/h1-5,9-16H,6-7H2/t9-,10-,11-,12+,20+/m1/s1 |
| InChIKey | LZOZRXVSJUWAKG-AUTUZEJTSA-N |
| XLogP | -0.17 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|