C28H31O8P — CID 10369601
(2S,4aS,5S,6R,7S,8R,8aR)-2-oxo-2,5,7-tris(phenylmethoxy)-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3,2]dioxaphosphinine-6,8-diol (PubChem CID 10369601) has the molecular formula C28H31O8P and a molecular weight of 526.52 g/mol. Its IUPAC name is (2S,4aS,5S,6R,7S,8R,8aR)-2-oxo-2,5,7-tris(phenylmethoxy)-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3,2]dioxaphosphinine-6,8-diol.
| Compound Name | (2S,4aS,5S,6R,7S,8R,8aR)-2-oxo-2,5,7-tris(phenylmethoxy)-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3,2]dioxaphosphinine-6,8-diol |
|---|---|
| PubChem CID | 10369601 |
| Molecular Formula | C28H31O8P |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (2S,4aS,5S,6R,7S,8R,8aR)-2-oxo-2,5,7-tris(phenylmethoxy)-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3,2]dioxaphosphinine-6,8-diol |
| SMILES | O=[P@@]1(OCc2ccccc2)OC[C@H]2[C@H](OCc3ccccc3)[C@@H](O)[C@H](OCc3ccccc3)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C28H31O8P/c29-24-26(32-16-20-10-4-1-5-11-20)23-19-35-37(31,34-18-22-14-8-3-9-15-22)36-27(23)25(30)28(24)33-17-21-12-6-2-7-13-21/h1-15,23-30H,16-19H2/t23-,24+,25-,26-,27+,28-,37+/m0/s1 |
| InChIKey | FYCMOLZDTIVNMF-PBKDYCDKSA-N |
| XLogP | 4.25 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|