C27H29O8P — CID 10673320
(1S,3S,5S,6R,7S,8S,9S)-3-oxo-3,7,8-tris(phenylmethoxy)-2,4-dioxa-3λ5-phosphabicyclo[3.3.1]nonane-6,9-diol (PubChem CID 10673320) has the molecular formula C27H29O8P and a molecular weight of 512.50 g/mol. Its IUPAC name is (1S,3S,5S,6R,7S,8S,9S)-3-oxo-3,7,8-tris(phenylmethoxy)-2,4-dioxa-3λ5-phosphabicyclo[3.3.1]nonane-6,9-diol.
| Compound Name | (1S,3S,5S,6R,7S,8S,9S)-3-oxo-3,7,8-tris(phenylmethoxy)-2,4-dioxa-3λ5-phosphabicyclo[3.3.1]nonane-6,9-diol |
|---|---|
| PubChem CID | 10673320 |
| Molecular Formula | C27H29O8P |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (1S,3S,5S,6R,7S,8S,9S)-3-oxo-3,7,8-tris(phenylmethoxy)-2,4-dioxa-3λ5-phosphabicyclo[3.3.1]nonane-6,9-diol |
| SMILES | O=[P@]1(OCc2ccccc2)O[C@H]2[C@H](O)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](O1)[C@H]2O |
| InChI | InChI=1S/C27H29O8P/c28-22-24-23(29)26(35-36(30,34-24)33-18-21-14-8-3-9-15-21)27(32-17-20-12-6-2-7-13-20)25(22)31-16-19-10-4-1-5-11-19/h1-15,22-29H,16-18H2/t22-,23-,24-,25-,26-,27-,36-/m0/s1 |
| InChIKey | OMWANDGVSNCYOU-VWUIPKEUSA-N |
| XLogP | 4.00 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|