C13H17O4P — CID 15170845
2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide (PubChem CID 15170845) has the molecular formula C13H17O4P and a molecular weight of 268.25 g/mol. Its IUPAC name is 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide.
| Compound Name | 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 15170845 |
| Molecular Formula | C13H17O4P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide |
| SMILES | C=CCC1COP(=O)(OCc2ccccc2)OC1 |
| InChI | InChI=1S/C13H17O4P/c1-2-6-13-10-16-18(14,17-11-13)15-9-12-7-4-3-5-8-12/h2-5,7-8,13H,1,6,9-11H2 |
| InChIKey | GUDGLOMCGPQWOB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|