About 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide
2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide (PubChem CID 15170845) has the molecular formula C13H17O4P
and a molecular weight of 268.25 g/mol. Its IUPAC name is 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide.
Molecular Properties
| Compound Name | 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide |
| PubChem CID | 15170845 |
| Molecular Formula | C13H17O4P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide |
| SMILES | C=CCC1COP(=O)(OCc2ccccc2)OC1 |
| InChI | InChI=1S/C13H17O4P/c1-2-6-13-10-16-18(14,17-11-13)15-9-12-7-4-3-5-8-12/h2-5,7-8,13H,1,6,9-11H2 |
| InChIKey | GUDGLOMCGPQWOB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide?
The IUPAC name of 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide (CID 15170845) is 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide.
What is the SMILES notation for 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide?
The canonical SMILES for 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide is C=CCC1COP(=O)(OCc2ccccc2)OC1.
What is the InChIKey of 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide?
The InChIKey is GUDGLOMCGPQWOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17O4P/c1-2-6-13-10-16-18(14,17-11-13)15-9-12-7-4-3-5-8-12/h2-5,7-8,13H,1,6,9-11H2.
What are the key properties of 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide?
2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide has a molecular weight of 268.25 g/mol, XLogP of 3.55, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxy-5-prop-2-enyl-1,3,2lambda5-dioxaphosphinane 2-oxide is sourced from PubChem (CID 15170845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).