C18H20FN2O6P — CID 90242849
1-[(2R,4aR,6R,7R,7aR)-7-fluoro-7-methyl-2-oxo-2-phenylmethoxy-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-methylidenepyrimidin-2-one (PubChem CID 90242849) has the molecular formula C18H20FN2O6P and a molecular weight of 410.34 g/mol. Its IUPAC name is 1-[(2R,4aR,6R,7R,7aR)-7-fluoro-7-methyl-2-oxo-2-phenylmethoxy-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-methylidenepyrimidin-2-one.
| Compound Name | 1-[(2R,4aR,6R,7R,7aR)-7-fluoro-7-methyl-2-oxo-2-phenylmethoxy-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-methylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 90242849 |
| Molecular Formula | C18H20FN2O6P |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-[(2R,4aR,6R,7R,7aR)-7-fluoro-7-methyl-2-oxo-2-phenylmethoxy-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-methylidenepyrimidin-2-one |
| SMILES | C=C1C=CN([C@@H]2O[C@@H]3CO[P@@](=O)(OCc4ccccc4)O[C@H]3[C@@]2(C)F)C(=O)N1 |
| InChI | InChI=1S/C18H20FN2O6P/c1-12-8-9-21(17(22)20-12)16-18(2,19)15-14(26-16)11-25-28(23,27-15)24-10-13-6-4-3-5-7-13/h3-9,14-16H,1,10-11H2,2H3,(H,20,22)/t14-,15-,16-,18-,28-/m1/s1 |
| InChIKey | ZLIGKPXPLDOJCS-GJGWIGEDSA-N |
| XLogP | 3.23 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|