C18H22N3O7P — CID 130437325
1-[(2R,5aR,7R,8R,8aS)-8-amino-8-methyl-2-oxo-2-phenylmethoxy-5,5a,7,8a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphepin-7-yl]pyrimidine-2,4-dione (PubChem CID 130437325) has the molecular formula C18H22N3O7P and a molecular weight of 423.36 g/mol. Its IUPAC name is 1-[(2R,5aR,7R,8R,8aS)-8-amino-8-methyl-2-oxo-2-phenylmethoxy-5,5a,7,8a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphepin-7-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5aR,7R,8R,8aS)-8-amino-8-methyl-2-oxo-2-phenylmethoxy-5,5a,7,8a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphepin-7-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 130437325 |
| Molecular Formula | C18H22N3O7P |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1-[(2R,5aR,7R,8R,8aS)-8-amino-8-methyl-2-oxo-2-phenylmethoxy-5,5a,7,8a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphepin-7-yl]pyrimidine-2,4-dione |
| SMILES | C[C@@]1(N)[C@@H]2O[P@@](=O)(OCc3ccccc3)OCC[C@H]2O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C18H22N3O7P/c1-18(19)15-13(27-16(18)21-9-7-14(22)20-17(21)23)8-10-25-29(24,28-15)26-11-12-5-3-2-4-6-12/h2-7,9,13,15-16H,8,10-11,19H2,1H3,(H,20,22,23)/t13-,15-,16-,18-,29-/m1/s1 |
| InChIKey | SEGNMCDYYDAICV-IVHGLTHQSA-N |
| XLogP | 1.28 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|