C22H27O8P — CID 71814775
[(2R,3S,4S,5S,6R)-6-(hydroxymethyl)-2-methoxy-2-oxo-4,5-bis(phenylmethoxy)-1,2λ5-oxaphosphinan-3-yl] acetate (PubChem CID 71814775) has the molecular formula C22H27O8P and a molecular weight of 450.42 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-6-(hydroxymethyl)-2-methoxy-2-oxo-4,5-bis(phenylmethoxy)-1,2λ5-oxaphosphinan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5S,6R)-6-(hydroxymethyl)-2-methoxy-2-oxo-4,5-bis(phenylmethoxy)-1,2λ5-oxaphosphinan-3-yl] acetate |
|---|---|
| PubChem CID | 71814775 |
| Molecular Formula | C22H27O8P |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-6-(hydroxymethyl)-2-methoxy-2-oxo-4,5-bis(phenylmethoxy)-1,2λ5-oxaphosphinan-3-yl] acetate |
| SMILES | CO[P@@]1(=O)O[C@H](CO)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H27O8P/c1-16(24)29-22-21(28-15-18-11-7-4-8-12-18)20(19(13-23)30-31(22,25)26-2)27-14-17-9-5-3-6-10-17/h3-12,19-23H,13-15H2,1-2H3/t19-,20-,21+,22+,31-/m1/s1 |
| InChIKey | IATNXRBLFMKEND-GVSKMIIFSA-N |
| XLogP | 3.28 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|