C26H29O6P — CID 10790441
(2S,3S,4S,5R)-2-methoxy-3,4,5-tris(phenylmethoxy)-1,2λ5-oxaphosphinane 2-oxide (PubChem CID 10790441) has the molecular formula C26H29O6P and a molecular weight of 468.49 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-methoxy-3,4,5-tris(phenylmethoxy)-1,2λ5-oxaphosphinane 2-oxide.
| Compound Name | (2S,3S,4S,5R)-2-methoxy-3,4,5-tris(phenylmethoxy)-1,2λ5-oxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 10790441 |
| Molecular Formula | C26H29O6P |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (2S,3S,4S,5R)-2-methoxy-3,4,5-tris(phenylmethoxy)-1,2λ5-oxaphosphinane 2-oxide |
| SMILES | CO[P@]1(=O)OC[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H29O6P/c1-28-33(27)26(31-19-23-15-9-4-10-16-23)25(30-18-22-13-7-3-8-14-22)24(20-32-33)29-17-21-11-5-2-6-12-21/h2-16,24-26H,17-20H2,1H3/t24-,25+,26+,33+/m1/s1 |
| InChIKey | KRGYWOLCWCHFGL-FYZNHFMZSA-N |
| XLogP | 5.57 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|