C18H23O9P — CID 134930068
[(2S,3R,4R,5S)-4,5-diacetyloxy-1-methoxy-1-oxo-2-phenylmethoxy-1λ5-phospholan-3-yl] acetate (PubChem CID 134930068) has the molecular formula C18H23O9P and a molecular weight of 414.35 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-4,5-diacetyloxy-1-methoxy-1-oxo-2-phenylmethoxy-1λ5-phospholan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S)-4,5-diacetyloxy-1-methoxy-1-oxo-2-phenylmethoxy-1λ5-phospholan-3-yl] acetate |
|---|---|
| PubChem CID | 134930068 |
| Molecular Formula | C18H23O9P |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [(2S,3R,4R,5S)-4,5-diacetyloxy-1-methoxy-1-oxo-2-phenylmethoxy-1λ5-phospholan-3-yl] acetate |
| SMILES | COP1(=O)[C@H](OCc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H23O9P/c1-11(19)25-15-16(26-12(2)20)18(27-13(3)21)28(22,23-4)17(15)24-10-14-8-6-5-7-9-14/h5-9,15-18H,10H2,1-4H3/t15-,16-,17+,18+,28?/m1/s1 |
| InChIKey | PDRZQZPWHVYERY-MHLDWTIFSA-N |
| XLogP | 2.22 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|