C27H33O10P — CID 23419532
[(1R,2S,3S,4S,5R,6R)-5,6-diacetyloxy-1-methoxy-1-oxo-4-phenylmethoxy-2-(phenylmethoxymethyl)-1λ5-phosphinan-3-yl] acetate (PubChem CID 23419532) has the molecular formula C27H33O10P and a molecular weight of 548.53 g/mol. Its IUPAC name is [(1R,2S,3S,4S,5R,6R)-5,6-diacetyloxy-1-methoxy-1-oxo-4-phenylmethoxy-2-(phenylmethoxymethyl)-1λ5-phosphinan-3-yl] acetate.
| Compound Name | [(1R,2S,3S,4S,5R,6R)-5,6-diacetyloxy-1-methoxy-1-oxo-4-phenylmethoxy-2-(phenylmethoxymethyl)-1λ5-phosphinan-3-yl] acetate |
|---|---|
| PubChem CID | 23419532 |
| Molecular Formula | C27H33O10P |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | [(1R,2S,3S,4S,5R,6R)-5,6-diacetyloxy-1-methoxy-1-oxo-4-phenylmethoxy-2-(phenylmethoxymethyl)-1λ5-phosphinan-3-yl] acetate |
| SMILES | CO[P@]1(=O)[C@@H](COCc2ccccc2)[C@@H](OC(C)=O)[C@H](OCc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H33O10P/c1-18(28)35-24-23(17-33-15-21-11-7-5-8-12-21)38(31,32-4)27(37-20(3)30)26(36-19(2)29)25(24)34-16-22-13-9-6-10-14-22/h5-14,23-27H,15-17H2,1-4H3/t23-,24+,25-,26+,27+,38+/m0/s1 |
| InChIKey | JUWWBZNDQQVNQN-YQNFKIKGSA-N |
| XLogP | 3.85 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|