C15H19BrO6 — CID 160818998
[(3S,6R)-6-bromo-4-hydroxy-2-(hydroxymethyl)-5-phenylmethoxyoxan-3-yl] acetate (PubChem CID 160818998) has the molecular formula C15H19BrO6 and a molecular weight of 375.22 g/mol. Its IUPAC name is [(3S,6R)-6-bromo-4-hydroxy-2-(hydroxymethyl)-5-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(3S,6R)-6-bromo-4-hydroxy-2-(hydroxymethyl)-5-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 160818998 |
| Molecular Formula | C15H19BrO6 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | [(3S,6R)-6-bromo-4-hydroxy-2-(hydroxymethyl)-5-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(CO)O[C@H](Br)C(OCc2ccccc2)C1O |
| InChI | InChI=1S/C15H19BrO6/c1-9(18)21-13-11(7-17)22-15(16)14(12(13)19)20-8-10-5-3-2-4-6-10/h2-6,11-15,17,19H,7-8H2,1H3/t11?,12?,13-,14?,15+/m1/s1 |
| InChIKey | SFHCHYHAYQSARQ-CVJJFLFCSA-N |
| XLogP | 0.98 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|