C8H17O3P — CID 23620614
(3S)-2-ethyl-3,5,5-trimethyl-2-oxo-1,2λ5-oxaphospholan-3-ol (PubChem CID 23620614) has the molecular formula C8H17O3P and a molecular weight of 192.19 g/mol. Its IUPAC name is (3S)-2-ethyl-3,5,5-trimethyl-2-oxo-1,2λ5-oxaphospholan-3-ol.
| Compound Name | (3S)-2-ethyl-3,5,5-trimethyl-2-oxo-1,2λ5-oxaphospholan-3-ol |
|---|---|
| PubChem CID | 23620614 |
| Molecular Formula | C8H17O3P |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (3S)-2-ethyl-3,5,5-trimethyl-2-oxo-1,2λ5-oxaphospholan-3-ol |
| SMILES | CCP1(=O)OC(C)(C)C[C@@]1(C)O |
| InChI | InChI=1S/C8H17O3P/c1-5-12(10)8(4,9)6-7(2,3)11-12/h9H,5-6H2,1-4H3/t8-,12?/m0/s1 |
| InChIKey | OWSLIKTYMPKFHD-KBPLZSHQSA-N |
| XLogP | 2.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|