C14H31N2O2P — CID 143387197
1,3-diethyl-2-methoxy-5,5,7,7-tetramethyl-1,3,2λ5-diazaphosphocane 2-oxide (PubChem CID 143387197) has the molecular formula C14H31N2O2P and a molecular weight of 290.39 g/mol. Its IUPAC name is 1,3-diethyl-2-methoxy-5,5,7,7-tetramethyl-1,3,2λ5-diazaphosphocane 2-oxide.
| Compound Name | 1,3-diethyl-2-methoxy-5,5,7,7-tetramethyl-1,3,2λ5-diazaphosphocane 2-oxide |
|---|---|
| PubChem CID | 143387197 |
| Molecular Formula | C14H31N2O2P |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 1,3-diethyl-2-methoxy-5,5,7,7-tetramethyl-1,3,2λ5-diazaphosphocane 2-oxide |
| SMILES | CCN1CC(C)(C)CC(C)(C)CN(CC)P1(=O)OC |
| InChI | InChI=1S/C14H31N2O2P/c1-8-15-11-13(3,4)10-14(5,6)12-16(9-2)19(15,17)18-7/h8-12H2,1-7H3 |
| InChIKey | KVMPSQDLSZRCLC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|