C23H27ClN2O6 — CID 89451814
2-[(3-butoxycarbonylphenyl)methyl-[2-(2-chloro-4-hydroxy-N-methylanilino)acetyl]amino]acetic acid (PubChem CID 89451814) has the molecular formula C23H27ClN2O6 and a molecular weight of 462.93 g/mol. Its IUPAC name is 2-[(3-butoxycarbonylphenyl)methyl-[2-(2-chloro-4-hydroxy-N-methylanilino)acetyl]amino]acetic acid.
| Compound Name | 2-[(3-butoxycarbonylphenyl)methyl-[2-(2-chloro-4-hydroxy-N-methylanilino)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 89451814 |
| Molecular Formula | C23H27ClN2O6 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[(3-butoxycarbonylphenyl)methyl-[2-(2-chloro-4-hydroxy-N-methylanilino)acetyl]amino]acetic acid |
| SMILES | CCCCOC(=O)c1cccc(CN(CC(=O)O)C(=O)CN(C)c2ccc(O)cc2Cl)c1 |
| InChI | InChI=1S/C23H27ClN2O6/c1-3-4-10-32-23(31)17-7-5-6-16(11-17)13-26(15-22(29)30)21(28)14-25(2)20-9-8-18(27)12-19(20)24/h5-9,11-12,27H,3-4,10,13-15H2,1-2H3,(H,29,30) |
| InChIKey | CFAHMLXDQDHJRS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|