C27H34ClNO6 — CID 89451943
butyl 3-[3-[(2-butoxy-2-oxoethyl)-[(2-chloro-4-hydroxyphenyl)methyl]amino]-3-oxopropyl]benzoate (PubChem CID 89451943) has the molecular formula C27H34ClNO6 and a molecular weight of 504.02 g/mol. Its IUPAC name is butyl 3-[3-[(2-butoxy-2-oxoethyl)-[(2-chloro-4-hydroxyphenyl)methyl]amino]-3-oxopropyl]benzoate.
| Compound Name | butyl 3-[3-[(2-butoxy-2-oxoethyl)-[(2-chloro-4-hydroxyphenyl)methyl]amino]-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 89451943 |
| Molecular Formula | C27H34ClNO6 |
| Molecular Weight | 504.02 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | butyl 3-[3-[(2-butoxy-2-oxoethyl)-[(2-chloro-4-hydroxyphenyl)methyl]amino]-3-oxopropyl]benzoate |
| SMILES | CCCCOC(=O)CN(Cc1ccc(O)cc1Cl)C(=O)CCc1cccc(C(=O)OCCCC)c1 |
| InChI | InChI=1S/C27H34ClNO6/c1-3-5-14-34-26(32)19-29(18-22-11-12-23(30)17-24(22)28)25(31)13-10-20-8-7-9-21(16-20)27(33)35-15-6-4-2/h7-9,11-12,16-17,30H,3-6,10,13-15,18-19H2,1-2H3 |
| InChIKey | USTSSJZMHXJZAF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.02 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|