C34H43Cl2NO3 — CID 11706947
(5Z,8Z,11Z,14Z)-N,N-bis[(2-chloro-4-hydroxyphenyl)methyl]icosa-5,8,11,14-tetraenamide (PubChem CID 11706947) has the molecular formula C34H43Cl2NO3 and a molecular weight of 584.63 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N,N-bis[(2-chloro-4-hydroxyphenyl)methyl]icosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N,N-bis[(2-chloro-4-hydroxyphenyl)methyl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 11706947 |
| Molecular Formula | C34H43Cl2NO3 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N,N-bis[(2-chloro-4-hydroxyphenyl)methyl]icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N(Cc1ccc(O)cc1Cl)Cc1ccc(O)cc1Cl |
| InChI | InChI=1S/C34H43Cl2NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-34(40)37(26-28-20-22-30(38)24-32(28)35)27-29-21-23-31(39)25-33(29)36/h6-7,9-10,12-13,15-16,20-25,38-39H,2-5,8,11,14,17-19,26-27H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | DGACELPSAULBQP-DOFZRALJSA-N |
| XLogP | 10.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|