C24H25N4O2PS — CID 89451865
N-(3-ethenylphosphanyloxyphenyl)-6-[5-(piperidin-1-ylmethyl)furan-2-yl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 89451865) has the molecular formula C24H25N4O2PS and a molecular weight of 464.53 g/mol. Its IUPAC name is N-(3-ethenylphosphanyloxyphenyl)-6-[5-(piperidin-1-ylmethyl)furan-2-yl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(3-ethenylphosphanyloxyphenyl)-6-[5-(piperidin-1-ylmethyl)furan-2-yl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 89451865 |
| Molecular Formula | C24H25N4O2PS |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-(3-ethenylphosphanyloxyphenyl)-6-[5-(piperidin-1-ylmethyl)furan-2-yl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | C=CPOc1cccc(Nc2ncnc3cc(-c4ccc(CN5CCCCC5)o4)sc23)c1 |
| InChI | InChI=1S/C24H25N4O2PS/c1-2-31-30-18-8-6-7-17(13-18)27-24-23-20(25-16-26-24)14-22(32-23)21-10-9-19(29-21)15-28-11-4-3-5-12-28/h2,6-10,13-14,16,31H,1,3-5,11-12,15H2,(H,25,26,27) |
| InChIKey | DPQLJIKUFIIIKZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|