C18H17ClN4S — CID 89452852
N-benzyl-11-chloro-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine (PubChem CID 89452852) has the molecular formula C18H17ClN4S and a molecular weight of 356.88 g/mol. Its IUPAC name is N-benzyl-11-chloro-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine.
| Compound Name | N-benzyl-11-chloro-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine |
|---|---|
| PubChem CID | 89452852 |
| Molecular Formula | C18H17ClN4S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-benzyl-11-chloro-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine |
| SMILES | Cc1nc2sc3c(NCc4ccccc4)nn(C)c3c2c(C)c1Cl |
| InChI | InChI=1S/C18H17ClN4S/c1-10-13-15-16(24-18(13)21-11(2)14(10)19)17(22-23(15)3)20-9-12-7-5-4-6-8-12/h4-8H,9H2,1-3H3,(H,20,22) |
| InChIKey | RRGGUNBHDQHVMD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |