C31H32N6O6S — CID 89454500
[4-[1-(benzenesulfonyl)-4-[1-ethyl-3-(4-nitrophenyl)pyrazol-4-yl]pyrrol-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone (PubChem CID 89454500) has the molecular formula C31H32N6O6S and a molecular weight of 616.70 g/mol. Its IUPAC name is [4-[1-(benzenesulfonyl)-4-[1-ethyl-3-(4-nitrophenyl)pyrazol-4-yl]pyrrol-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[1-(benzenesulfonyl)-4-[1-ethyl-3-(4-nitrophenyl)pyrazol-4-yl]pyrrol-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 89454500 |
| Molecular Formula | C31H32N6O6S |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | [4-[1-(benzenesulfonyl)-4-[1-ethyl-3-(4-nitrophenyl)pyrazol-4-yl]pyrrol-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone |
| SMILES | CCn1cc(-c2cc(C3=CCN(C(=O)N4CCOCC4)CC3)n(S(=O)(=O)c3ccccc3)c2)c(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C31H32N6O6S/c1-2-35-22-28(30(32-35)24-8-10-26(11-9-24)37(39)40)25-20-29(36(21-25)44(41,42)27-6-4-3-5-7-27)23-12-14-33(15-13-23)31(38)34-16-18-43-19-17-34/h3-12,20-22H,2,13-19H2,1H3 |
| InChIKey | UFCOBNVDMZVVPC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 132.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|