C18H12F4N2O3S — CID 89461642
2-[5,6,7-trifluoro-2-(3-fluorobenzoyl)imino-1,3-benzothiazol-3-yl]butanoic acid (PubChem CID 89461642) has the molecular formula C18H12F4N2O3S and a molecular weight of 412.36 g/mol. Its IUPAC name is 2-[5,6,7-trifluoro-2-(3-fluorobenzoyl)imino-1,3-benzothiazol-3-yl]butanoic acid.
| Compound Name | 2-[5,6,7-trifluoro-2-(3-fluorobenzoyl)imino-1,3-benzothiazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 89461642 |
| Molecular Formula | C18H12F4N2O3S |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 2-[5,6,7-trifluoro-2-(3-fluorobenzoyl)imino-1,3-benzothiazol-3-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1/c(=N/C(=O)c2cccc(F)c2)sc2c(F)c(F)c(F)cc21 |
| InChI | InChI=1S/C18H12F4N2O3S/c1-2-11(17(26)27)24-12-7-10(20)13(21)14(22)15(12)28-18(24)23-16(25)8-4-3-5-9(19)6-8/h3-7,11H,2H2,1H3,(H,26,27)/b23-18- |
| InChIKey | QZAMAKHYBCKMGQ-NKFKGCMQSA-N |
| XLogP | 4.04 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|