C18H17N3O3S — CID 89461889
2-[2-(4-aminobenzoyl)imino-1,3-benzothiazol-3-yl]butanoic acid (PubChem CID 89461889) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[2-(4-aminobenzoyl)imino-1,3-benzothiazol-3-yl]butanoic acid.
| Compound Name | 2-[2-(4-aminobenzoyl)imino-1,3-benzothiazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 89461889 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[2-(4-aminobenzoyl)imino-1,3-benzothiazol-3-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1/c(=N/C(=O)c2ccc(N)cc2)sc2ccccc21 |
| InChI | InChI=1S/C18H17N3O3S/c1-2-13(17(23)24)21-14-5-3-4-6-15(14)25-18(21)20-16(22)11-7-9-12(19)10-8-11/h3-10,13H,2,19H2,1H3,(H,23,24)/b20-18- |
| InChIKey | FAANQSDOJQLMPJ-ZZEZOPTASA-N |
| XLogP | 3.06 |
| TPSA | 97.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|