C21H19N3O3S — CID 71543046
2-[2-(1-methylindole-3-carbonyl)imino-1,3-benzothiazol-3-yl]butanoic acid (PubChem CID 71543046) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[2-(1-methylindole-3-carbonyl)imino-1,3-benzothiazol-3-yl]butanoic acid.
| Compound Name | 2-[2-(1-methylindole-3-carbonyl)imino-1,3-benzothiazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 71543046 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-[2-(1-methylindole-3-carbonyl)imino-1,3-benzothiazol-3-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1/c(=N/C(=O)c2cn(C)c3ccccc23)sc2ccccc21 |
| InChI | InChI=1S/C21H19N3O3S/c1-3-15(20(26)27)24-17-10-6-7-11-18(17)28-21(24)22-19(25)14-12-23(2)16-9-5-4-8-13(14)16/h4-12,15H,3H2,1-2H3,(H,26,27)/b22-21- |
| InChIKey | HYVCTSKWYVRBGK-DQRAZIAOSA-N |
| XLogP | 3.97 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |